C20H23BrN2O3S — CID 69236011
2-[2-[(5-bromo-2-methoxyphenyl)methylsulfanylmethyl]phenyl]-1,4,5,6-tetrahydropyrimidine;formic acid (PubChem CID 69236011) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is 2-[2-[(5-bromo-2-methoxyphenyl)methylsulfanylmethyl]phenyl]-1,4,5,6-tetrahydropyrimidine;formic acid.
| Compound Name | 2-[2-[(5-bromo-2-methoxyphenyl)methylsulfanylmethyl]phenyl]-1,4,5,6-tetrahydropyrimidine;formic acid |
|---|---|
| PubChem CID | 69236011 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-[2-[(5-bromo-2-methoxyphenyl)methylsulfanylmethyl]phenyl]-1,4,5,6-tetrahydropyrimidine;formic acid |
| SMILES | COc1ccc(Br)cc1CSCc1ccccc1C1=NCCCN1.O=CO |
| InChI | InChI=1S/C19H21BrN2OS.CH2O2/c1-23-18-8-7-16(20)11-15(18)13-24-12-14-5-2-3-6-17(14)19-21-9-4-10-22-19;2-1-3/h2-3,5-8,11H,4,9-10,12-13H2,1H3,(H,21,22);1H,(H,2,3) |
| InChIKey | ZCXRSKPIMVKLAJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|