C18H18BrClN2OS — CID 22744812
(5-bromo-2-methoxyphenyl)-[2-chloro-6-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]methanethiol (PubChem CID 22744812) has the molecular formula C18H18BrClN2OS and a molecular weight of 425.78 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)-[2-chloro-6-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]methanethiol.
| Compound Name | (5-bromo-2-methoxyphenyl)-[2-chloro-6-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]methanethiol |
|---|---|
| PubChem CID | 22744812 |
| Molecular Formula | C18H18BrClN2OS |
| Molecular Weight | 425.78 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)-[2-chloro-6-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]methanethiol |
| SMILES | COc1ccc(Br)cc1C(S)c1c(Cl)cccc1C1=NCCCN1 |
| InChI | InChI=1S/C18H18BrClN2OS/c1-23-15-7-6-11(19)10-13(15)17(24)16-12(4-2-5-14(16)20)18-21-8-3-9-22-18/h2,4-7,10,17,24H,3,8-9H2,1H3,(H,21,22) |
| InChIKey | CNCYXZGVAUCUGO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.78 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|