C17H19N3O — CID 82249227
N-(2-methoxyphenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-yl)aniline (PubChem CID 82249227) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-yl)aniline.
| Compound Name | N-(2-methoxyphenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-yl)aniline |
|---|---|
| PubChem CID | 82249227 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(2-methoxyphenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-yl)aniline |
| SMILES | COc1ccccc1Nc1ccccc1C1=NCCCN1 |
| InChI | InChI=1S/C17H19N3O/c1-21-16-10-5-4-9-15(16)20-14-8-3-2-7-13(14)17-18-11-6-12-19-17/h2-5,7-10,20H,6,11-12H2,1H3,(H,18,19) |
| InChIKey | LBDRAVZFHZZNIF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |