C17H16ClN3O — CID 82252768
2-chloro-N-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide (PubChem CID 82252768) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-chloro-N-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide.
| Compound Name | 2-chloro-N-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 82252768 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-chloro-N-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C1=NCCCN1)c1ccccc1Cl |
| InChI | InChI=1S/C17H16ClN3O/c18-14-8-3-1-6-12(14)17(22)21-15-9-4-2-7-13(15)16-19-10-5-11-20-16/h1-4,6-9H,5,10-11H2,(H,19,20)(H,21,22) |
| InChIKey | KYAYWGSSOMDBQX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |