C13H17N3O2 — CID 82244461
3-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)anilino]propanoic acid (PubChem CID 82244461) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)anilino]propanoic acid.
| Compound Name | 3-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)anilino]propanoic acid |
|---|---|
| PubChem CID | 82244461 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-[2-(1,4,5,6-tetrahydropyrimidin-2-yl)anilino]propanoic acid |
| SMILES | O=C(O)CCNc1ccccc1C1=NCCCN1 |
| InChI | InChI=1S/C13H17N3O2/c17-12(18)6-9-14-11-5-2-1-4-10(11)13-15-7-3-8-16-13/h1-2,4-5,14H,3,6-9H2,(H,15,16)(H,17,18) |
| InChIKey | REMKTFXDEVCMTC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |