C15H23FN4 — CID 82248809
N-[3-fluoro-2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 82248809) has the molecular formula C15H23FN4 and a molecular weight of 278.38 g/mol. Its IUPAC name is N-[3-fluoro-2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[3-fluoro-2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82248809 |
| Molecular Formula | C15H23FN4 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | N-[3-fluoro-2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1cccc(F)c1C1=NCCCN1 |
| InChI | InChI=1S/C15H23FN4/c1-20(2)11-5-10-17-13-7-3-6-12(16)14(13)15-18-8-4-9-19-15/h3,6-7,17H,4-5,8-11H2,1-2H3,(H,18,19) |
| InChIKey | RCNSFFJUUQVAEJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|