C14H23IN4 — CID 110914236
N'-methyl-N'-phenyl-N-(1,4,5,6-tetrahydropyrimidin-2-yl)propane-1,3-diamine;hydroiodide (PubChem CID 110914236) has the molecular formula C14H23IN4 and a molecular weight of 374.27 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-(1,4,5,6-tetrahydropyrimidin-2-yl)propane-1,3-diamine;hydroiodide.
| Compound Name | N'-methyl-N'-phenyl-N-(1,4,5,6-tetrahydropyrimidin-2-yl)propane-1,3-diamine;hydroiodide |
|---|---|
| PubChem CID | 110914236 |
| Molecular Formula | C14H23IN4 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N'-methyl-N'-phenyl-N-(1,4,5,6-tetrahydropyrimidin-2-yl)propane-1,3-diamine;hydroiodide |
| SMILES | CN(CCCNC1=NCCCN1)c1ccccc1.I |
| InChI | InChI=1S/C14H22N4.HI/c1-18(13-7-3-2-4-8-13)12-6-11-17-14-15-9-5-10-16-14;/h2-4,7-8H,5-6,9-12H2,1H3,(H2,15,16,17);1H |
| InChIKey | UFMHAOWWYQXELV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|