C22H29N3 — CID 19820500
N-(3,3-diphenylpropyl)-4,5,6,7,8,9-hexahydro-1H-1,3-diazonin-2-amine (PubChem CID 19820500) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-4,5,6,7,8,9-hexahydro-1H-1,3-diazonin-2-amine.
| Compound Name | N-(3,3-diphenylpropyl)-4,5,6,7,8,9-hexahydro-1H-1,3-diazonin-2-amine |
|---|---|
| PubChem CID | 19820500 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | N-(3,3-diphenylpropyl)-4,5,6,7,8,9-hexahydro-1H-1,3-diazonin-2-amine |
| SMILES | c1ccc(C(CCN/C2=N/CCCCCCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H29N3/c1-2-10-17-24-22(23-16-9-1)25-18-15-21(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-8,11-14,21H,1-2,9-10,15-18H2,(H2,23,24,25) |
| InChIKey | ZHTMSCIJGWZTAD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |