C11H13FN2O — CID 82241523
2-(2-fluoro-6-methoxyphenyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 82241523) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-(2-fluoro-6-methoxyphenyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(2-fluoro-6-methoxyphenyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 82241523 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(2-fluoro-6-methoxyphenyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | COc1cccc(F)c1C1=NCCCN1 |
| InChI | InChI=1S/C11H13FN2O/c1-15-9-5-2-4-8(12)10(9)11-13-6-3-7-14-11/h2,4-5H,3,6-7H2,1H3,(H,13,14) |
| InChIKey | RPGXBBUHXYSTRM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |