C11H14N2OS — CID 2345497
N-(2-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 2345497) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(2-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 2345497 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(2-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | COc1ccccc1NC1=NCCCS1 |
| InChI | InChI=1S/C11H14N2OS/c1-14-10-6-3-2-5-9(10)13-11-12-7-4-8-15-11/h2-3,5-6H,4,7-8H2,1H3,(H,12,13) |
| InChIKey | MCNOURIAPOKCRE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |