C17H18N2OS — CID 83179343
4-methyl-N-(2-phenoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 83179343) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-methyl-N-(2-phenoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | 4-methyl-N-(2-phenoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 83179343 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-methyl-N-(2-phenoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CC1CCSC(Nc2ccccc2Oc2ccccc2)=N1 |
| InChI | InChI=1S/C17H18N2OS/c1-13-11-12-21-17(18-13)19-15-9-5-6-10-16(15)20-14-7-3-2-4-8-14/h2-10,13H,11-12H2,1H3,(H,18,19) |
| InChIKey | OAXHJKAYOPVESY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |