C15H19N3O3 — CID 137034895
(Z)-3-hydroxy-N-(2-methoxyphenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide (PubChem CID 137034895) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (Z)-3-hydroxy-N-(2-methoxyphenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide.
| Compound Name | (Z)-3-hydroxy-N-(2-methoxyphenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 137034895 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (Z)-3-hydroxy-N-(2-methoxyphenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide |
| SMILES | COc1ccccc1NC(=O)/C(C1=NCCCN1)=C(/C)O |
| InChI | InChI=1S/C15H19N3O3/c1-10(19)13(14-16-8-5-9-17-14)15(20)18-11-6-3-4-7-12(11)21-2/h3-4,6-7,19H,5,8-9H2,1-2H3,(H,16,17)(H,18,20)/b13-10- |
| InChIKey | OBQCPJDGVNZNOQ-RAXLEYEMSA-N |
| XLogP | 1.86 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|