C12H21N3O2 — CID 137034911
(Z)-N,N-diethyl-3-hydroxy-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide (PubChem CID 137034911) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is (Z)-N,N-diethyl-3-hydroxy-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide.
| Compound Name | (Z)-N,N-diethyl-3-hydroxy-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 137034911 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | (Z)-N,N-diethyl-3-hydroxy-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide |
| SMILES | CCN(CC)C(=O)/C(C1=NCCCN1)=C(/C)O |
| InChI | InChI=1S/C12H21N3O2/c1-4-15(5-2)12(17)10(9(3)16)11-13-7-6-8-14-11/h16H,4-8H2,1-3H3,(H,13,14)/b10-9- |
| InChIKey | IYFWMOJXNQLAON-KTKRTIGZSA-N |
| XLogP | 1.08 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|