About 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline
3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline (PubChem CID 68913933) has the molecular formula C17H19N3
and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| PubChem CID | 68913933 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| SMILES | Nc1cccc(Cc2ccccc2)c1CC1=NCCN1 |
| InChI | InChI=1S/C17H19N3/c18-16-8-4-7-14(11-13-5-2-1-3-6-13)15(16)12-17-19-9-10-20-17/h1-8H,9-12,18H2,(H,19,20) |
| InChIKey | NRHPDGBMUOMKGP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The IUPAC name of 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline (CID 68913933) is 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline.
What is the SMILES notation for 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The canonical SMILES for 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline is Nc1cccc(Cc2ccccc2)c1CC1=NCCN1.
What is the InChIKey of 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The InChIKey is NRHPDGBMUOMKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3/c18-16-8-4-7-14(11-13-5-2-1-3-6-13)15(16)12-17-19-9-10-20-17/h1-8H,9-12,18H2,(H,19,20).
What are the key properties of 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline has a molecular weight of 265.36 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline is sourced from PubChem (CID 68913933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).