C10H13N3 — CID 22493434
2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline (PubChem CID 22493434) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline.
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 22493434 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| SMILES | Nc1ccccc1CC1=NCCN1 |
| InChI | InChI=1S/C10H13N3/c11-9-4-2-1-3-8(9)7-10-12-5-6-13-10/h1-4H,5-7,11H2,(H,12,13) |
| InChIKey | HKPLDTMZDAKBRQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|