About 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol
4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol (PubChem CID 58951794) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol |
| PubChem CID | 58951794 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol |
| SMILES | Cc1cc(CC2=NCCN2)c(C)cc1O |
| InChI | InChI=1S/C12H16N2O/c1-8-6-11(15)9(2)5-10(8)7-12-13-3-4-14-12/h5-6,15H,3-4,7H2,1-2H3,(H,13,14) |
| InChIKey | RXLWGCHCALYBPA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol?
The IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol (CID 58951794) is 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol.
What is the SMILES notation for 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol?
The canonical SMILES for 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol is Cc1cc(CC2=NCCN2)c(C)cc1O.
What is the InChIKey of 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol?
The InChIKey is RXLWGCHCALYBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-8-6-11(15)9(2)5-10(8)7-12-13-3-4-14-12/h5-6,15H,3-4,7H2,1-2H3,(H,13,14).
What are the key properties of 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol?
4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol has a molecular weight of 204.27 g/mol, XLogP of 1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol is sourced from PubChem (CID 58951794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).