C12H16N2O — CID 58951794
4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol (PubChem CID 58951794) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol.
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol |
|---|---|
| PubChem CID | 58951794 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,5-dimethylphenol |
| SMILES | Cc1cc(CC2=NCCN2)c(C)cc1O |
| InChI | InChI=1S/C12H16N2O/c1-8-6-11(15)9(2)5-10(8)7-12-13-3-4-14-12/h5-6,15H,3-4,7H2,1-2H3,(H,13,14) |
| InChIKey | RXLWGCHCALYBPA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |