C11H11N3O2 — CID 121220339
2-[(E)-2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1H-imidazole (PubChem CID 121220339) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-[(E)-2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[(E)-2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 121220339 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-[(E)-2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1H-imidazole |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C2=NCCN2)cc1 |
| InChI | InChI=1S/C11H11N3O2/c15-14(16)10-4-1-9(2-5-10)3-6-11-12-7-8-13-11/h1-6H,7-8H2,(H,12,13)/b6-3+ |
| InChIKey | WGNKKLNYYFMSQM-ZZXKWVIFSA-N |
| XLogP | 1.61 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|