C22H25N5O6S — CID 45272502
tert-butyl 4-[1-(2-nitrophenyl)sulfonylpyrrolo[3,2-b]pyridin-6-yl]piperazine-1-carboxylate (PubChem CID 45272502) has the molecular formula C22H25N5O6S and a molecular weight of 487.54 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-nitrophenyl)sulfonylpyrrolo[3,2-b]pyridin-6-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-nitrophenyl)sulfonylpyrrolo[3,2-b]pyridin-6-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 45272502 |
| Molecular Formula | C22H25N5O6S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | tert-butyl 4-[1-(2-nitrophenyl)sulfonylpyrrolo[3,2-b]pyridin-6-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cnc3ccn(S(=O)(=O)c4ccccc4[N+](=O)[O-])c3c2)CC1 |
| InChI | InChI=1S/C22H25N5O6S/c1-22(2,3)33-21(28)25-12-10-24(11-13-25)16-14-19-17(23-15-16)8-9-26(19)34(31,32)20-7-5-4-6-18(20)27(29)30/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | VIMRQMREQPFTPW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 127.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|