C29H30IN5O6S — CID 90031353
tert-butyl 4-[4-[3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-2-nitrophenyl]piperazine-1-carboxylate (PubChem CID 90031353) has the molecular formula C29H30IN5O6S and a molecular weight of 703.56 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-2-nitrophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-2-nitrophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90031353 |
| Molecular Formula | C29H30IN5O6S |
| Molecular Weight | 703.56 g/mol |
| Exact Mass | 703.10 |
| IUPAC Name | tert-butyl 4-[4-[3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-2-nitrophenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(I)c3cc(-c4ccc(N5CCN(C(=O)OC(C)(C)C)CC5)c([N+](=O)[O-])c4)cnc32)cc1 |
| InChI | InChI=1S/C29H30IN5O6S/c1-19-5-8-22(9-6-19)42(39,40)34-18-24(30)23-15-21(17-31-27(23)34)20-7-10-25(26(16-20)35(37)38)32-11-13-33(14-12-32)28(36)41-29(2,3)4/h5-10,15-18H,11-14H2,1-4H3 |
| InChIKey | QFJVGUZBFAQIKU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 127.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|