C24H29N3O4S — CID 171771805
tert-butyl 4-[1-(4-methylphenyl)sulfonylindol-4-yl]piperazine-1-carboxylate (PubChem CID 171771805) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-methylphenyl)sulfonylindol-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-methylphenyl)sulfonylindol-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171771805 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | tert-butyl 4-[1-(4-methylphenyl)sulfonylindol-4-yl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N4CCN(C(=O)OC(C)(C)C)CC4)cccc32)cc1 |
| InChI | InChI=1S/C24H29N3O4S/c1-18-8-10-19(11-9-18)32(29,30)27-13-12-20-21(6-5-7-22(20)27)25-14-16-26(17-15-25)23(28)31-24(2,3)4/h5-13H,14-17H2,1-4H3 |
| InChIKey | NNEHEHGCNOVKFR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |