C24H28ClN3O4S — CID 25221710
tert-butyl 4-[[1-(3-chlorophenyl)sulfonylindol-4-yl]amino]piperidine-1-carboxylate (PubChem CID 25221710) has the molecular formula C24H28ClN3O4S and a molecular weight of 490.03 g/mol. Its IUPAC name is tert-butyl 4-[[1-(3-chlorophenyl)sulfonylindol-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(3-chlorophenyl)sulfonylindol-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25221710 |
| Molecular Formula | C24H28ClN3O4S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | tert-butyl 4-[[1-(3-chlorophenyl)sulfonylindol-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cccc3c2ccn3S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H28ClN3O4S/c1-24(2,3)32-23(29)27-13-10-18(11-14-27)26-21-8-5-9-22-20(21)12-15-28(22)33(30,31)19-7-4-6-17(25)16-19/h4-9,12,15-16,18,26H,10-11,13-14H2,1-3H3 |
| InChIKey | NDMDSXHWOGWPGS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |