C20H20F3N3O2S — CID 162664825
1-(benzenesulfonyl)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]indole (PubChem CID 162664825) has the molecular formula C20H20F3N3O2S and a molecular weight of 423.46 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]indole.
| Compound Name | 1-(benzenesulfonyl)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]indole |
|---|---|
| PubChem CID | 162664825 |
| Molecular Formula | C20H20F3N3O2S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]indole |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(N3CCN(CC(F)(F)F)CC3)cccc21 |
| InChI | InChI=1S/C20H20F3N3O2S/c21-20(22,23)15-24-11-13-25(14-12-24)18-7-4-8-19-17(18)9-10-26(19)29(27,28)16-5-2-1-3-6-16/h1-10H,11-15H2 |
| InChIKey | AIORBGLECYEESN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |