C22H23Cl2N3O2S — CID 10183265
1-naphthalen-2-ylsulfonyl-4-piperazin-1-ylindole;dihydrochloride (PubChem CID 10183265) has the molecular formula C22H23Cl2N3O2S and a molecular weight of 464.42 g/mol. Its IUPAC name is 1-naphthalen-2-ylsulfonyl-4-piperazin-1-ylindole;dihydrochloride.
| Compound Name | 1-naphthalen-2-ylsulfonyl-4-piperazin-1-ylindole;dihydrochloride |
|---|---|
| PubChem CID | 10183265 |
| Molecular Formula | C22H23Cl2N3O2S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 1-naphthalen-2-ylsulfonyl-4-piperazin-1-ylindole;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(c1ccc2ccccc2c1)n1ccc2c(N3CCNCC3)cccc21 |
| InChI | InChI=1S/C22H21N3O2S.2ClH/c26-28(27,19-9-8-17-4-1-2-5-18(17)16-19)25-13-10-20-21(6-3-7-22(20)25)24-14-11-23-12-15-24;;/h1-10,13,16,23H,11-12,14-15H2;2*1H |
| InChIKey | KGJULEKJQXTZKE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |