C22H24N4O5S — CID 157455881
formic acid;6-(4-piperazin-1-ylindol-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 157455881) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is formic acid;6-(4-piperazin-1-ylindol-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | formic acid;6-(4-piperazin-1-ylindol-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 157455881 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | formic acid;6-(4-piperazin-1-ylindol-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(S(=O)(=O)n3ccc4c(N5CCNCC5)cccc43)ccc2N1.O=CO |
| InChI | InChI=1S/C21H22N4O3S.CH2O2/c26-21-7-4-15-14-16(5-6-18(15)23-21)29(27,28)25-11-8-17-19(2-1-3-20(17)25)24-12-9-22-10-13-24;2-1-3/h1-3,5-6,8,11,14,22H,4,7,9-10,12-13H2,(H,23,26);1H,(H,2,3) |
| InChIKey | BTITWLGUISOYBS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|