C19H20FN3O3S — CID 118181436
4-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonylindole (PubChem CID 118181436) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonylindole.
| Compound Name | 4-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 118181436 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-fluoro-1-(4-methoxy-3-piperazin-1-ylphenyl)sulfonylindole |
| SMILES | COc1ccc(S(=O)(=O)n2ccc3c(F)cccc32)cc1N1CCNCC1 |
| InChI | InChI=1S/C19H20FN3O3S/c1-26-19-6-5-14(13-18(19)22-11-8-21-9-12-22)27(24,25)23-10-7-15-16(20)3-2-4-17(15)23/h2-7,10,13,21H,8-9,11-12H2,1H3 |
| InChIKey | ZEWMNRMNMWWOPX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |