About 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine
1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine (PubChem CID 142181785) has the molecular formula C19H22N2O3S
and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine |
| PubChem CID | 142181785 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine |
| SMILES | C1CCNC1.COc1cccc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13NO3S.C4H9N/c1-19-15-9-5-8-14-13(15)10-11-16(14)20(17,18)12-6-3-2-4-7-12;1-2-4-5-3-1/h2-11H,1H3;5H,1-4H2 |
| InChIKey | CMNZGKNBUJUOLQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine?
The IUPAC name of 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine (CID 142181785) is 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine.
What is the SMILES notation for 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine?
The canonical SMILES for 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine is C1CCNC1.COc1cccc2c1ccn2S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine?
The InChIKey is CMNZGKNBUJUOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3S.C4H9N/c1-19-15-9-5-8-14-13(15)10-11-16(14)20(17,18)12-6-3-2-4-7-12;1-2-4-5-3-1/h2-11H,1H3;5H,1-4H2.
What are the key properties of 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine?
1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine has a molecular weight of 358.46 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-4-methoxyindole;pyrrolidine is sourced from PubChem (CID 142181785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).