C17H18N2O3S — CID 11461668
2-[1-(benzenesulfonyl)indol-4-yl]oxy-N-methylethanamine (PubChem CID 11461668) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)indol-4-yl]oxy-N-methylethanamine.
| Compound Name | 2-[1-(benzenesulfonyl)indol-4-yl]oxy-N-methylethanamine |
|---|---|
| PubChem CID | 11461668 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[1-(benzenesulfonyl)indol-4-yl]oxy-N-methylethanamine |
| SMILES | CNCCOc1cccc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-18-11-13-22-17-9-5-8-16-15(17)10-12-19(16)23(20,21)14-6-3-2-4-7-14/h2-10,12,18H,11,13H2,1H3 |
| InChIKey | IPBMHVYZRXHUBV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|