C24H33NO3S — CID 143603116
1-(benzenesulfonyl)-4-ethyl-5-methoxyindole;ethane;methylcyclobutane (PubChem CID 143603116) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-ethyl-5-methoxyindole;ethane;methylcyclobutane.
| Compound Name | 1-(benzenesulfonyl)-4-ethyl-5-methoxyindole;ethane;methylcyclobutane |
|---|---|
| PubChem CID | 143603116 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-(benzenesulfonyl)-4-ethyl-5-methoxyindole;ethane;methylcyclobutane |
| SMILES | CC.CC1CCC1.CCc1c(OC)ccc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17NO3S.C5H10.C2H6/c1-3-14-15-11-12-18(16(15)9-10-17(14)21-2)22(19,20)13-7-5-4-6-8-13;1-5-3-2-4-5;1-2/h4-12H,3H2,1-2H3;5H,2-4H2,1H3;1-2H3 |
| InChIKey | VMXKCZHGJGVJKV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |