C20H20N2O4S — CID 174572774
methyl 1-[[1-(benzenesulfonyl)indol-4-yl]methyl]azetidine-2-carboxylate (PubChem CID 174572774) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is methyl 1-[[1-(benzenesulfonyl)indol-4-yl]methyl]azetidine-2-carboxylate.
| Compound Name | methyl 1-[[1-(benzenesulfonyl)indol-4-yl]methyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 174572774 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | methyl 1-[[1-(benzenesulfonyl)indol-4-yl]methyl]azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1Cc1cccc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-26-20(23)19-11-12-21(19)14-15-6-5-9-18-17(15)10-13-22(18)27(24,25)16-7-3-2-4-8-16/h2-10,13,19H,11-12,14H2,1H3 |
| InChIKey | ATBMAKLUGAEURJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |