C21H21F3N2O3S — CID 70843107
[1-[[1-[3-(trifluoromethyl)phenyl]sulfonylindol-4-yl]methyl]pyrrolidin-2-yl]methanol (PubChem CID 70843107) has the molecular formula C21H21F3N2O3S and a molecular weight of 438.47 g/mol. Its IUPAC name is [1-[[1-[3-(trifluoromethyl)phenyl]sulfonylindol-4-yl]methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[[1-[3-(trifluoromethyl)phenyl]sulfonylindol-4-yl]methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 70843107 |
| Molecular Formula | C21H21F3N2O3S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [1-[[1-[3-(trifluoromethyl)phenyl]sulfonylindol-4-yl]methyl]pyrrolidin-2-yl]methanol |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)n1ccc2c(CN3CCCC3CO)cccc21 |
| InChI | InChI=1S/C21H21F3N2O3S/c22-21(23,24)16-5-2-7-18(12-16)30(28,29)26-11-9-19-15(4-1-8-20(19)26)13-25-10-3-6-17(25)14-27/h1-2,4-5,7-9,11-12,17,27H,3,6,10,13-14H2 |
| InChIKey | CDXZEVWWQKUSJR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |