C23H20N2O6S — CID 174572790
benzene-1,3-dicarboxylic acid;[1-(benzenesulfonyl)indol-4-yl]methanamine (PubChem CID 174572790) has the molecular formula C23H20N2O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;[1-(benzenesulfonyl)indol-4-yl]methanamine.
| Compound Name | benzene-1,3-dicarboxylic acid;[1-(benzenesulfonyl)indol-4-yl]methanamine |
|---|---|
| PubChem CID | 174572790 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;[1-(benzenesulfonyl)indol-4-yl]methanamine |
| SMILES | NCc1cccc2c1ccn2S(=O)(=O)c1ccccc1.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H14N2O2S.C8H6O4/c16-11-12-5-4-8-15-14(12)9-10-17(15)20(18,19)13-6-2-1-3-7-13;9-7(10)5-2-1-3-6(4-5)8(11)12/h1-10H,11,16H2;1-4H,(H,9,10)(H,11,12) |
| InChIKey | SLNOELQTUGFLOW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |