C23H19NO6S — CID 174496817
1-(benzenesulfonyl)indole;4-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174496817) has the molecular formula C23H19NO6S and a molecular weight of 437.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)indole;4-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 1-(benzenesulfonyl)indole;4-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174496817 |
| Molecular Formula | C23H19NO6S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 1-(benzenesulfonyl)indole;4-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)O.O=S(=O)(c1ccccc1)n1ccc2ccccc21 |
| InChI | InChI=1S/C14H11NO2S.C9H8O4/c16-18(17,13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)15;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h1-11H;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | CRZXLEAQGZJIMN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |