C20H22N2O3S — CID 24775196
1-(benzenesulfonyl)-6-methoxy-4-(pyrrolidin-1-ylmethyl)indole (PubChem CID 24775196) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-methoxy-4-(pyrrolidin-1-ylmethyl)indole.
| Compound Name | 1-(benzenesulfonyl)-6-methoxy-4-(pyrrolidin-1-ylmethyl)indole |
|---|---|
| PubChem CID | 24775196 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-(benzenesulfonyl)-6-methoxy-4-(pyrrolidin-1-ylmethyl)indole |
| SMILES | COc1cc(CN2CCCC2)c2ccn(S(=O)(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C20H22N2O3S/c1-25-17-13-16(15-21-10-5-6-11-21)19-9-12-22(20(19)14-17)26(23,24)18-7-3-2-4-8-18/h2-4,7-9,12-14H,5-6,10-11,15H2,1H3 |
| InChIKey | NSEDEDZWGZLOFH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |