C17H18N2O2S2 — CID 24774937
4-(pyrrolidin-1-ylmethyl)-1-thiophen-2-ylsulfonylindole (PubChem CID 24774937) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 4-(pyrrolidin-1-ylmethyl)-1-thiophen-2-ylsulfonylindole.
| Compound Name | 4-(pyrrolidin-1-ylmethyl)-1-thiophen-2-ylsulfonylindole |
|---|---|
| PubChem CID | 24774937 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-(pyrrolidin-1-ylmethyl)-1-thiophen-2-ylsulfonylindole |
| SMILES | O=S(=O)(c1cccs1)n1ccc2c(CN3CCCC3)cccc21 |
| InChI | InChI=1S/C17H18N2O2S2/c20-23(21,17-7-4-12-22-17)19-11-8-15-14(5-3-6-16(15)19)13-18-9-1-2-10-18/h3-8,11-12H,1-2,9-10,13H2 |
| InChIKey | FWNNVNPKOUDNKW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |