C22H25FN2O2S — CID 143603060
1-(benzenesulfonyl)-6-fluoro-4-[(1-methylazepan-4-yl)methyl]indole (PubChem CID 143603060) has the molecular formula C22H25FN2O2S and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-fluoro-4-[(1-methylazepan-4-yl)methyl]indole.
| Compound Name | 1-(benzenesulfonyl)-6-fluoro-4-[(1-methylazepan-4-yl)methyl]indole |
|---|---|
| PubChem CID | 143603060 |
| Molecular Formula | C22H25FN2O2S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-(benzenesulfonyl)-6-fluoro-4-[(1-methylazepan-4-yl)methyl]indole |
| SMILES | CN1CCCC(Cc2cc(F)cc3c2ccn3S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25FN2O2S/c1-24-11-5-6-17(9-12-24)14-18-15-19(23)16-22-21(18)10-13-25(22)28(26,27)20-7-3-2-4-8-20/h2-4,7-8,10,13,15-17H,5-6,9,11-12,14H2,1H3 |
| InChIKey | GQXGBCOUGLWTCB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |