C24H28FN3O2S — CID 25222495
N-(cyclopropylmethyl)-1-(4-fluorophenyl)sulfonyl-N-(1-methylpiperidin-4-yl)indol-4-amine (PubChem CID 25222495) has the molecular formula C24H28FN3O2S and a molecular weight of 441.57 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(4-fluorophenyl)sulfonyl-N-(1-methylpiperidin-4-yl)indol-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-(4-fluorophenyl)sulfonyl-N-(1-methylpiperidin-4-yl)indol-4-amine |
|---|---|
| PubChem CID | 25222495 |
| Molecular Formula | C24H28FN3O2S |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(4-fluorophenyl)sulfonyl-N-(1-methylpiperidin-4-yl)indol-4-amine |
| SMILES | CN1CCC(N(CC2CC2)c2cccc3c2ccn3S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H28FN3O2S/c1-26-14-11-20(12-15-26)27(17-18-5-6-18)23-3-2-4-24-22(23)13-16-28(24)31(29,30)21-9-7-19(25)8-10-21/h2-4,7-10,13,16,18,20H,5-6,11-12,14-15,17H2,1H3 |
| InChIKey | FRKFAEGAWYLZGC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |