C16H22N2O2S — CID 162666403
1-cyclohexylsulfonyl-N,N-dimethylindol-4-amine (PubChem CID 162666403) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-N,N-dimethylindol-4-amine.
| Compound Name | 1-cyclohexylsulfonyl-N,N-dimethylindol-4-amine |
|---|---|
| PubChem CID | 162666403 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-cyclohexylsulfonyl-N,N-dimethylindol-4-amine |
| SMILES | CN(C)c1cccc2c1ccn2S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H22N2O2S/c1-17(2)15-9-6-10-16-14(15)11-12-18(16)21(19,20)13-7-4-3-5-8-13/h6,9-13H,3-5,7-8H2,1-2H3 |
| InChIKey | QKVXCXPLARYCAT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |