C20H31N — CID 175316009
2,3-dicyclohexyl-N,N-dimethylaniline (PubChem CID 175316009) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is 2,3-dicyclohexyl-N,N-dimethylaniline.
| Compound Name | 2,3-dicyclohexyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 175316009 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 2,3-dicyclohexyl-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C2CCCCC2)c1C1CCCCC1 |
| InChI | InChI=1S/C20H31N/c1-21(2)19-15-9-14-18(16-10-5-3-6-11-16)20(19)17-12-7-4-8-13-17/h9,14-17H,3-8,10-13H2,1-2H3 |
| InChIKey | XNOZTCJFDOMMCV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |