C20H31N — CID 156891849
2,6-di(cycloheptyl)aniline (PubChem CID 156891849) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is 2,6-di(cycloheptyl)aniline.
| Compound Name | 2,6-di(cycloheptyl)aniline |
|---|---|
| PubChem CID | 156891849 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 2,6-di(cycloheptyl)aniline |
| SMILES | Nc1c(C2CCCCCC2)cccc1C1CCCCCC1 |
| InChI | InChI=1S/C20H31N/c21-20-18(16-10-5-1-2-6-11-16)14-9-15-19(20)17-12-7-3-4-8-13-17/h9,14-17H,1-8,10-13,21H2 |
| InChIKey | SZLWYXBUMMVVNP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|