C14H19N — CID 172550384
2,6-di(cyclobutyl)aniline (PubChem CID 172550384) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2,6-di(cyclobutyl)aniline.
| Compound Name | 2,6-di(cyclobutyl)aniline |
|---|---|
| PubChem CID | 172550384 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2,6-di(cyclobutyl)aniline |
| SMILES | Nc1c(C2CCC2)cccc1C1CCC1 |
| InChI | InChI=1S/C14H19N/c15-14-12(10-4-1-5-10)8-3-9-13(14)11-6-2-7-11/h3,8-11H,1-2,4-7,15H2 |
| InChIKey | LKLZIPDZCYGGSQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|