C14H18O — CID 57426118
2,6-di(cyclobutyl)phenol (PubChem CID 57426118) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2,6-di(cyclobutyl)phenol.
| Compound Name | 2,6-di(cyclobutyl)phenol |
|---|---|
| PubChem CID | 57426118 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2,6-di(cyclobutyl)phenol |
| SMILES | Oc1c(C2CCC2)cccc1C1CCC1 |
| InChI | InChI=1S/C14H18O/c15-14-12(10-4-1-5-10)8-3-9-13(14)11-6-2-7-11/h3,8-11,15H,1-2,4-7H2 |
| InChIKey | FVYQGCRSDKPZIK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |