C13H18O2 — CID 150190518
3-cyclohexyl-6-methylbenzene-1,2-diol (PubChem CID 150190518) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-cyclohexyl-6-methylbenzene-1,2-diol.
| Compound Name | 3-cyclohexyl-6-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 150190518 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-cyclohexyl-6-methylbenzene-1,2-diol |
| SMILES | Cc1ccc(C2CCCCC2)c(O)c1O |
| InChI | InChI=1S/C13H18O2/c1-9-7-8-11(13(15)12(9)14)10-5-3-2-4-6-10/h7-8,10,14-15H,2-6H2,1H3 |
| InChIKey | FNILVSQVEWSKDW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|