C10H10O2 — CID 157394257
3-cyclopropyl-2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 157394257) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-cyclopropyl-2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 3-cyclopropyl-2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 157394257 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 3-cyclopropyl-2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1ccccc(C2CC2)c1O |
| InChI | InChI=1S/C10H10O2/c11-9-4-2-1-3-8(10(9)12)7-5-6-7/h1-4,7H,5-6H2,(H,11,12) |
| InChIKey | ZENJTJURMPYMLS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |