C19H26BNO4S — CID 153394928
1-cyclopentylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 153394928) has the molecular formula C19H26BNO4S and a molecular weight of 375.30 g/mol. Its IUPAC name is 1-cyclopentylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-cyclopentylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 153394928 |
| Molecular Formula | C19H26BNO4S |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-cyclopentylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2cccc3c2ccn3S(=O)(=O)C2CCCC2)OC1(C)C |
| InChI | InChI=1S/C19H26BNO4S/c1-18(2)19(3,4)25-20(24-18)16-10-7-11-17-15(16)12-13-21(17)26(22,23)14-8-5-6-9-14/h7,10-14H,5-6,8-9H2,1-4H3 |
| InChIKey | PMMROCOXUYYFDI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|