C14H19BN2O4S — CID 151921890
1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 151921890) has the molecular formula C14H19BN2O4S and a molecular weight of 322.19 g/mol. Its IUPAC name is 1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 151921890 |
| Molecular Formula | C14H19BN2O4S |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CC1(C)OB(c2cccc3c2cnn3S(C)(=O)=O)OC1(C)C |
| InChI | InChI=1S/C14H19BN2O4S/c1-13(2)14(3,4)21-15(20-13)11-7-6-8-12-10(11)9-16-17(12)22(5,18)19/h6-9H,1-5H3 |
| InChIKey | SWXYUHJASGRVLD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|