C30H30BCl3N8O2 — CID 159843608
4-(2-chloropyrimidin-4-yl)-1-methylindazole;2,4-dichloropyrimidine;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 159843608) has the molecular formula C30H30BCl3N8O2 and a molecular weight of 651.80 g/mol. Its IUPAC name is 4-(2-chloropyrimidin-4-yl)-1-methylindazole;2,4-dichloropyrimidine;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 4-(2-chloropyrimidin-4-yl)-1-methylindazole;2,4-dichloropyrimidine;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 159843608 |
| Molecular Formula | C30H30BCl3N8O2 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | 4-(2-chloropyrimidin-4-yl)-1-methylindazole;2,4-dichloropyrimidine;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Clc1ccnc(Cl)n1.Cn1ncc2c(-c3ccnc(Cl)n3)cccc21.Cn1ncc2c(B3OC(C)(C)C(C)(C)O3)cccc21 |
| InChI | InChI=1S/C14H19BN2O2.C12H9ClN4.C4H2Cl2N2/c1-13(2)14(3,4)19-15(18-13)11-7-6-8-12-10(11)9-16-17(12)5;1-17-11-4-2-3-8(9(11)7-15-17)10-5-6-14-12(13)16-10;5-3-1-2-7-4(6)8-3/h6-9H,1-5H3;2-7H,1H3;1-2H |
| InChIKey | NOZUHBBGFGWOFV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|