C34H42BCl3N4O2 — CID 159160905
2-chloro-4-(3-methyl-4-propan-2-ylphenyl)pyrimidine;2,4-dichloropyrimidine;4,4,5,5-tetramethyl-2-(3-methyl-4-propan-2-ylphenyl)-1,3,2-dioxaborolane (PubChem CID 159160905) has the molecular formula C34H42BCl3N4O2 and a molecular weight of 655.91 g/mol. Its IUPAC name is 2-chloro-4-(3-methyl-4-propan-2-ylphenyl)pyrimidine;2,4-dichloropyrimidine;4,4,5,5-tetramethyl-2-(3-methyl-4-propan-2-ylphenyl)-1,3,2-dioxaborolane.
| Compound Name | 2-chloro-4-(3-methyl-4-propan-2-ylphenyl)pyrimidine;2,4-dichloropyrimidine;4,4,5,5-tetramethyl-2-(3-methyl-4-propan-2-ylphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159160905 |
| Molecular Formula | C34H42BCl3N4O2 |
| Molecular Weight | 655.91 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | 2-chloro-4-(3-methyl-4-propan-2-ylphenyl)pyrimidine;2,4-dichloropyrimidine;4,4,5,5-tetramethyl-2-(3-methyl-4-propan-2-ylphenyl)-1,3,2-dioxaborolane |
| SMILES | Cc1cc(-c2ccnc(Cl)n2)ccc1C(C)C.Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1C(C)C.Clc1ccnc(Cl)n1 |
| InChI | InChI=1S/C16H25BO2.C14H15ClN2.C4H2Cl2N2/c1-11(2)14-9-8-13(10-12(14)3)17-18-15(4,5)16(6,7)19-17;1-9(2)12-5-4-11(8-10(12)3)13-6-7-16-14(15)17-13;5-3-1-2-7-4(6)8-3/h8-11H,1-7H3;4-9H,1-3H3;1-2H |
| InChIKey | KKLVFUVTMNGSHV-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.91 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|