C17H23BN2O2 — CID 172645210
5-propan-2-yl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline (PubChem CID 172645210) has the molecular formula C17H23BN2O2 and a molecular weight of 298.19 g/mol. Its IUPAC name is 5-propan-2-yl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline.
| Compound Name | 5-propan-2-yl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
|---|---|
| PubChem CID | 172645210 |
| Molecular Formula | C17H23BN2O2 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 5-propan-2-yl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
| SMILES | CC(C)c1ccc(B2OC(C)(C)C(C)(C)O2)c2nccnc12 |
| InChI | InChI=1S/C17H23BN2O2/c1-11(2)12-7-8-13(15-14(12)19-9-10-20-15)18-21-16(3,4)17(5,6)22-18/h7-11H,1-6H3 |
| InChIKey | CHDJXQSCEDTIBY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|