C16H23BN2O2 — CID 175198522
1-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine (PubChem CID 175198522) has the molecular formula C16H23BN2O2 and a molecular weight of 286.18 g/mol. Its IUPAC name is 1-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine.
| Compound Name | 1-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 175198522 |
| Molecular Formula | C16H23BN2O2 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine |
| SMILES | CC(C)n1cc(B2OC(C)(C)C(C)(C)O2)c2ncccc21 |
| InChI | InChI=1S/C16H23BN2O2/c1-11(2)19-10-12(14-13(19)8-7-9-18-14)17-20-15(3,4)16(5,6)21-17/h7-11H,1-6H3 |
| InChIKey | YOANMHNWKQZGNT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|