C12H16BF2NO3 — CID 131618120
3-(difluoromethoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 131618120) has the molecular formula C12H16BF2NO3 and a molecular weight of 271.07 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-(difluoromethoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 131618120 |
| Molecular Formula | C12H16BF2NO3 |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-(difluoromethoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2ncccc2OC(F)F)OC1(C)C |
| InChI | InChI=1S/C12H16BF2NO3/c1-11(2)12(3,4)19-13(18-11)9-8(17-10(14)15)6-5-7-16-9/h5-7,10H,1-4H3 |
| InChIKey | QOZZKTTWEFJTHZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|